C12H19N — CID 101003710
2-cyclohexylidene-4,4-dimethyl-3H-pyrrole (PubChem CID 101003710) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 2-cyclohexylidene-4,4-dimethyl-3H-pyrrole.
| Compound Name | 2-cyclohexylidene-4,4-dimethyl-3H-pyrrole |
|---|---|
| PubChem CID | 101003710 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 2-cyclohexylidene-4,4-dimethyl-3H-pyrrole |
| SMILES | CC1(C)C=NC(=C2CCCCC2)C1 |
| InChI | InChI=1S/C12H19N/c1-12(2)8-11(13-9-12)10-6-4-3-5-7-10/h9H,3-8H2,1-2H3 |
| InChIKey | BFTKJOVKMVPYAU-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |