C12H20O2 — CID 154048821
2-(hydroxymethyl)-3,3-dimethyl-4,5,6,7-tetrahydro-1H-inden-2-ol (PubChem CID 154048821) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,3-dimethyl-4,5,6,7-tetrahydro-1H-inden-2-ol.
| Compound Name | 2-(hydroxymethyl)-3,3-dimethyl-4,5,6,7-tetrahydro-1H-inden-2-ol |
|---|---|
| PubChem CID | 154048821 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-(hydroxymethyl)-3,3-dimethyl-4,5,6,7-tetrahydro-1H-inden-2-ol |
| SMILES | CC1(C)C2=C(CCCC2)CC1(O)CO |
| InChI | InChI=1S/C12H20O2/c1-11(2)10-6-4-3-5-9(10)7-12(11,14)8-13/h13-14H,3-8H2,1-2H3 |
| InChIKey | XZHRWRGKDJSALV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|