C20H33NO2Si — CID 101003970
N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-4-yn-3-yl]hydroxylamine (PubChem CID 101003970) has the molecular formula C20H33NO2Si and a molecular weight of 347.58 g/mol. Its IUPAC name is N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-4-yn-3-yl]hydroxylamine.
| Compound Name | N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-4-yn-3-yl]hydroxylamine |
|---|---|
| PubChem CID | 101003970 |
| Molecular Formula | C20H33NO2Si |
| Molecular Weight | 347.58 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | N-benzyl-N-[6-[tert-butyl(dimethyl)silyl]oxy-2-methylhex-4-yn-3-yl]hydroxylamine |
| SMILES | CC(C)C(C#CCO[Si](C)(C)C(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H33NO2Si/c1-17(2)19(21(22)16-18-12-9-8-10-13-18)14-11-15-23-24(6,7)20(3,4)5/h8-10,12-13,17,19,22H,15-16H2,1-7H3 |
| InChIKey | KKTPEBBUVLJWEC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|