C21H33NOSi — CID 14359847
(E)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-prop-2-ynylpent-2-en-1-amine (PubChem CID 14359847) has the molecular formula C21H33NOSi and a molecular weight of 343.59 g/mol. Its IUPAC name is (E)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-prop-2-ynylpent-2-en-1-amine.
| Compound Name | (E)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-prop-2-ynylpent-2-en-1-amine |
|---|---|
| PubChem CID | 14359847 |
| Molecular Formula | C21H33NOSi |
| Molecular Weight | 343.59 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | (E)-N-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-N-prop-2-ynylpent-2-en-1-amine |
| SMILES | C#CCN(C/C=C/C(C)O[Si](C)(C)C(C)(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C21H33NOSi/c1-8-16-22(18-20-14-10-9-11-15-20)17-12-13-19(2)23-24(6,7)21(3,4)5/h1,9-15,19H,16-18H2,2-7H3/b13-12+ |
| InChIKey | NMZNGNPRIXTNKN-OUKQBFOZSA-N |
| XLogP | 5.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|