C18H17O6+ — CID 101008371
2-(4-hydroxy-3-methoxyphenyl)-3,5-dimethoxychromenylium-7-ol (PubChem CID 101008371) has the molecular formula C18H17O6+ and a molecular weight of 329.33 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)-3,5-dimethoxychromenylium-7-ol.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)-3,5-dimethoxychromenylium-7-ol |
|---|---|
| PubChem CID | 101008371 |
| Molecular Formula | C18H17O6+ |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-3,5-dimethoxychromenylium-7-ol |
| SMILES | COc1cc(-c2[o+]c3cc(O)cc(OC)c3cc2OC)ccc1O |
| InChI | InChI=1S/C18H16O6/c1-21-14-7-11(19)8-15-12(14)9-17(23-3)18(24-15)10-4-5-13(20)16(6-10)22-2/h4-9H,1-3H3,(H-,19,20)/p+1 |
| InChIKey | RAYDAFXCPXZHMK-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|