C17H15O5+ — CID 158034915
2-(4-hydroxy-3-methoxyphenyl)-7-methylchromenylium-3,5-diol (PubChem CID 158034915) has the molecular formula C17H15O5+ and a molecular weight of 299.30 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxyphenyl)-7-methylchromenylium-3,5-diol.
| Compound Name | 2-(4-hydroxy-3-methoxyphenyl)-7-methylchromenylium-3,5-diol |
|---|---|
| PubChem CID | 158034915 |
| Molecular Formula | C17H15O5+ |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 2-(4-hydroxy-3-methoxyphenyl)-7-methylchromenylium-3,5-diol |
| SMILES | COc1cc(-c2[o+]c3cc(C)cc(O)c3cc2O)ccc1O |
| InChI | InChI=1S/C17H14O5/c1-9-5-13(19)11-8-14(20)17(22-15(11)6-9)10-3-4-12(18)16(7-10)21-2/h3-8H,1-2H3,(H2-,18,19,20)/p+1 |
| InChIKey | HKGMFXCOXADFOZ-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|