C30H23ClO12+2 — CID 173046871
bis(2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol);hydrochloride (PubChem CID 173046871) has the molecular formula C30H23ClO12+2 and a molecular weight of 610.96 g/mol. Its IUPAC name is bis(2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol);hydrochloride.
| Compound Name | bis(2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol);hydrochloride |
|---|---|
| PubChem CID | 173046871 |
| Molecular Formula | C30H23ClO12+2 |
| Molecular Weight | 610.96 g/mol |
| Exact Mass | 610.09 |
| IUPAC Name | bis(2-(3,4-dihydroxyphenyl)chromenylium-3,5,7-triol);hydrochloride |
| SMILES | Cl.Oc1cc(O)c2cc(O)c(-c3ccc(O)c(O)c3)[o+]c2c1.Oc1cc(O)c2cc(O)c(-c3ccc(O)c(O)c3)[o+]c2c1 |
| InChI | InChI=1S/2C15H10O6.ClH/c2*16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7;/h2*1-6H,(H4-,16,17,18,19,20);1H/p+2 |
| InChIKey | QKLWDPIMLPAAMI-UHFFFAOYSA-P |
| XLogP | 6.24 |
| TPSA | 224.90 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.96 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|