C24H26N2O5 — CID 101010617
(4S)-4-[(4-hydroxyphenyl)methyl]-3-[(4R,5S)-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carbonyl]-1,3-oxazolidin-2-one (PubChem CID 101010617) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is (4S)-4-[(4-hydroxyphenyl)methyl]-3-[(4R,5S)-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carbonyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-[(4-hydroxyphenyl)methyl]-3-[(4R,5S)-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carbonyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101010617 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (4S)-4-[(4-hydroxyphenyl)methyl]-3-[(4R,5S)-5-methyl-3-(2,4,6-trimethylphenyl)-4,5-dihydro-1,2-oxazole-4-carbonyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1cc(C)c(C2=NO[C@@H](C)[C@@H]2C(=O)N2C(=O)OC[C@@H]2Cc2ccc(O)cc2)c(C)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-13-9-14(2)20(15(3)10-13)22-21(16(4)31-25-22)23(28)26-18(12-30-24(26)29)11-17-5-7-19(27)8-6-17/h5-10,16,18,21,27H,11-12H2,1-4H3/t16-,18-,21-/m0/s1 |
| InChIKey | HRBLBVUQBWXCKM-MDKPJZGXSA-N |
| XLogP | 3.65 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |