C38H34O8S2 — CID 10101102
[3,5-bis(4-methylphenyl)-3-methylsulfonyloxy-2,6-diphenyl-2,6-dihydrofuro[3,2-f][1]benzofuran-5-yl] methanesulfonate (PubChem CID 10101102) has the molecular formula C38H34O8S2 and a molecular weight of 682.82 g/mol. Its IUPAC name is [3,5-bis(4-methylphenyl)-3-methylsulfonyloxy-2,6-diphenyl-2,6-dihydrofuro[3,2-f][1]benzofuran-5-yl] methanesulfonate.
| Compound Name | [3,5-bis(4-methylphenyl)-3-methylsulfonyloxy-2,6-diphenyl-2,6-dihydrofuro[3,2-f][1]benzofuran-5-yl] methanesulfonate |
|---|---|
| PubChem CID | 10101102 |
| Molecular Formula | C38H34O8S2 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | [3,5-bis(4-methylphenyl)-3-methylsulfonyloxy-2,6-diphenyl-2,6-dihydrofuro[3,2-f][1]benzofuran-5-yl] methanesulfonate |
| SMILES | Cc1ccc(C2(OS(C)(=O)=O)c3cc4c(cc3OC2c2ccccc2)OC(c2ccccc2)C4(OS(C)(=O)=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C38H34O8S2/c1-25-15-19-29(20-16-25)37(45-47(3,39)40)31-23-32-34(24-33(31)43-35(37)27-11-7-5-8-12-27)44-36(28-13-9-6-10-14-28)38(32,46-48(4,41)42)30-21-17-26(2)18-22-30/h5-24,35-36H,1-4H3 |
| InChIKey | QSULFOQUGDYAAS-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|