C35H33NO4 — CID 158341048
methyl (2R,3S,3aR,8bR)-8b-(benzylamino)-6,8-dimethyl-3a-(4-methylphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate (PubChem CID 158341048) has the molecular formula C35H33NO4 and a molecular weight of 531.65 g/mol. Its IUPAC name is methyl (2R,3S,3aR,8bR)-8b-(benzylamino)-6,8-dimethyl-3a-(4-methylphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate.
| Compound Name | methyl (2R,3S,3aR,8bR)-8b-(benzylamino)-6,8-dimethyl-3a-(4-methylphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 158341048 |
| Molecular Formula | C35H33NO4 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | methyl (2R,3S,3aR,8bR)-8b-(benzylamino)-6,8-dimethyl-3a-(4-methylphenyl)-1-oxo-3-phenyl-2,3-dihydrocyclopenta[b][1]benzofuran-2-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)[C@@]2(NCc3ccccc3)c3c(C)cc(C)cc3O[C@@]2(c2ccc(C)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C35H33NO4/c1-22-15-17-27(18-16-22)35-31(26-13-9-6-10-14-26)29(33(38)39-4)32(37)34(35,36-21-25-11-7-5-8-12-25)30-24(3)19-23(2)20-28(30)40-35/h5-20,29,31,36H,21H2,1-4H3/t29-,31-,34+,35+/m1/s1 |
| InChIKey | JBRGFFGJTMWWTR-IYWWYKGUSA-N |
| XLogP | 6.04 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|