C27H25BNO7 — CID 174005483
CID 174005483 (PubChem CID 174005483) has the molecular formula C27H25BNO7 and a molecular weight of 486.31 g/mol.
| Compound Name | CID 174005483 |
|---|---|
| PubChem CID | 174005483 |
| Molecular Formula | C27H25BNO7 |
| Molecular Weight | 486.31 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | — |
| SMILES | C[B]c1ccc([C@@]23Oc4cc(OC)nc(OC)c4[C@]2(O)C(=O)[C@H](C(=O)OC)[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25BNO7/c1-28-17-12-10-16(11-13-17)27-21(15-8-6-5-7-9-15)20(25(31)35-4)23(30)26(27,32)22-18(36-27)14-19(33-2)29-24(22)34-3/h5-14,20-21,32H,1-4H3/t20-,21-,26+,27+/m1/s1 |
| InChIKey | AMHANIYCVQTBEV-UXUXNBJMSA-N |
| XLogP | 2.11 |
| TPSA | 104.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|