C26H24BrNO8 — CID 140787864
methyl (1R,10S,11S)-9-(4-bromophenyl)-1,12,12-trihydroxy-3,5-dimethoxy-10-phenyl-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate (PubChem CID 140787864) has the molecular formula C26H24BrNO8 and a molecular weight of 558.38 g/mol. Its IUPAC name is methyl (1R,10S,11S)-9-(4-bromophenyl)-1,12,12-trihydroxy-3,5-dimethoxy-10-phenyl-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate.
| Compound Name | methyl (1R,10S,11S)-9-(4-bromophenyl)-1,12,12-trihydroxy-3,5-dimethoxy-10-phenyl-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 140787864 |
| Molecular Formula | C26H24BrNO8 |
| Molecular Weight | 558.38 g/mol |
| Exact Mass | 557.07 |
| IUPAC Name | methyl (1R,10S,11S)-9-(4-bromophenyl)-1,12,12-trihydroxy-3,5-dimethoxy-10-phenyl-8-oxa-4-azatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](c2ccccc2)C2(c3ccc(Br)cc3)Oc3cc(OC)nc(OC)c3[C@@]1(O)C2(O)O |
| InChI | InChI=1S/C26H24BrNO8/c1-33-18-13-17-20(22(28-18)34-2)24(30)21(23(29)35-3)19(14-7-5-4-6-8-14)25(36-17,26(24,31)32)15-9-11-16(27)12-10-15/h4-13,19,21,30-32H,1-3H3/t19-,21-,24+,25?/m1/s1 |
| InChIKey | OVNLWVGCTZPTCJ-UOQZAGKVSA-N |
| XLogP | 2.60 |
| TPSA | 127.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|