C27H25N3O7 — CID 176713582
(2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-N,10,12-trimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide (PubChem CID 176713582) has the molecular formula C27H25N3O7 and a molecular weight of 503.51 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-N,10,12-trimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide.
| Compound Name | (2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-N,10,12-trimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
|---|---|
| PubChem CID | 176713582 |
| Molecular Formula | C27H25N3O7 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (2S,3R,4R,5S,6R)-6-(4-cyanophenyl)-2,3-dihydroxy-N,10,12-trimethoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-4-carboxamide |
| SMILES | CONC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3c(cc(OC)nc3OC)O[C@@]2(c2ccc(C#N)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H25N3O7/c1-34-19-13-18-22(25(29-19)35-2)26(33)23(31)20(24(32)30-36-3)21(16-7-5-4-6-8-16)27(26,37-18)17-11-9-15(14-28)10-12-17/h4-13,20-21,23,31,33H,1-3H3,(H,30,32)/t20-,21-,23-,26+,27+/m1/s1 |
| InChIKey | WTENXFJWMGLPQX-WFINZZCUSA-N |
| XLogP | 1.90 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|