C28H28ClNO8 — CID 56946635
(1R,2R,3S,3aR,8bS)-5-chloro-1,8b-dihydroxy-N,6,8-trimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide (PubChem CID 56946635) has the molecular formula C28H28ClNO8 and a molecular weight of 541.98 g/mol. Its IUPAC name is (1R,2R,3S,3aR,8bS)-5-chloro-1,8b-dihydroxy-N,6,8-trimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide.
| Compound Name | (1R,2R,3S,3aR,8bS)-5-chloro-1,8b-dihydroxy-N,6,8-trimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 56946635 |
| Molecular Formula | C28H28ClNO8 |
| Molecular Weight | 541.98 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | (1R,2R,3S,3aR,8bS)-5-chloro-1,8b-dihydroxy-N,6,8-trimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
| SMILES | CONC(=O)[C@H]1[C@@H](O)[C@@]2(O)c3c(OC)cc(OC)c(Cl)c3O[C@@]2(c2ccc(OC)cc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C28H28ClNO8/c1-34-17-12-10-16(11-13-17)28-21(15-8-6-5-7-9-15)20(26(32)30-37-4)25(31)27(28,33)22-18(35-2)14-19(36-3)23(29)24(22)38-28/h5-14,20-21,25,31,33H,1-4H3,(H,30,32)/t20-,21-,25-,27+,28+/m1/s1 |
| InChIKey | RFMBOFDGFUHTGA-IKLPSFCOSA-N |
| XLogP | 3.29 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|