C25H31NO7 — CID 101011067
4-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-oxidomorpholin-4-ium (PubChem CID 101011067) has the molecular formula C25H31NO7 and a molecular weight of 457.52 g/mol. Its IUPAC name is 4-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-oxidomorpholin-4-ium.
| Compound Name | 4-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-oxidomorpholin-4-ium |
|---|---|
| PubChem CID | 101011067 |
| Molecular Formula | C25H31NO7 |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 4-[(4aR,6S,7S,8R,8aS)-6-methoxy-2-phenyl-7-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]-4-oxidomorpholin-4-ium |
| SMILES | CO[C@H]1O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]([N+]2([O-])CCOCC2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H31NO7/c1-28-25-23(30-16-18-8-4-2-5-9-18)21(26(27)12-14-29-15-13-26)22-20(32-25)17-31-24(33-22)19-10-6-3-7-11-19/h2-11,20-25H,12-17H2,1H3/t20-,21-,22-,23+,24?,25+/m1/s1 |
| InChIKey | UOKRESWQKLYSHY-DAVWFFPLSA-N |
| XLogP | 2.77 |
| TPSA | 78.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|