C17H19F3O3S — CID 101011731
[(Z)-2-ethoxy-1,1,1-trifluoronon-2-en-4-yn-3-yl]sulfonylbenzene (PubChem CID 101011731) has the molecular formula C17H19F3O3S and a molecular weight of 360.40 g/mol. Its IUPAC name is [(Z)-2-ethoxy-1,1,1-trifluoronon-2-en-4-yn-3-yl]sulfonylbenzene.
| Compound Name | [(Z)-2-ethoxy-1,1,1-trifluoronon-2-en-4-yn-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 101011731 |
| Molecular Formula | C17H19F3O3S |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | [(Z)-2-ethoxy-1,1,1-trifluoronon-2-en-4-yn-3-yl]sulfonylbenzene |
| SMILES | CCCCC#C/C(=C(/OCC)C(F)(F)F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19F3O3S/c1-3-5-6-10-13-15(16(23-4-2)17(18,19)20)24(21,22)14-11-8-7-9-12-14/h7-9,11-12H,3-6H2,1-2H3/b16-15- |
| InChIKey | YZPKRSLAIVKZQK-NXVVXOECSA-N |
| XLogP | 4.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|