C21H24O5 — CID 101012842
3-[[(1R,3S)-3-(phenylmethoxymethyl)-1,3-dihydro-2-benzofuran-1-yl]oxy]propyl acetate (PubChem CID 101012842) has the molecular formula C21H24O5 and a molecular weight of 356.42 g/mol. Its IUPAC name is 3-[[(1R,3S)-3-(phenylmethoxymethyl)-1,3-dihydro-2-benzofuran-1-yl]oxy]propyl acetate.
| Compound Name | 3-[[(1R,3S)-3-(phenylmethoxymethyl)-1,3-dihydro-2-benzofuran-1-yl]oxy]propyl acetate |
|---|---|
| PubChem CID | 101012842 |
| Molecular Formula | C21H24O5 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-[[(1R,3S)-3-(phenylmethoxymethyl)-1,3-dihydro-2-benzofuran-1-yl]oxy]propyl acetate |
| SMILES | CC(=O)OCCCO[C@@H]1O[C@H](COCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H24O5/c1-16(22)24-12-7-13-25-21-19-11-6-5-10-18(19)20(26-21)15-23-14-17-8-3-2-4-9-17/h2-6,8-11,20-21H,7,12-15H2,1H3/t20-,21-/m1/s1 |
| InChIKey | HFCRSODLXIOGMS-NHCUHLMSSA-N |
| XLogP | 3.94 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|