sodium 5-cyclohexylpentanoate

C11H19NaO2 — CID 101013497

IUPACsodium 5-cyclohexylpentanoate
SMILESO=C([O-])CCCCC1CCCCC1.[Na+]
InChIInChI=1S/C11H20O2.Na/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;/h10H,1-9H2,(H,12,13);/q;+1/p-1
InChIKeyAVLWCVAOCNUJGQ-UHFFFAOYSA-M
MW206.26 g/mol
LogP-1.12
Rot. Bonds5

About sodium 5-cyclohexylpentanoate

sodium 5-cyclohexylpentanoate (PubChem CID 101013497) has the molecular formula C11H19NaO2 and a molecular weight of 206.26 g/mol. Its IUPAC name is sodium 5-cyclohexylpentanoate.

Molecular Properties

Compound Namesodium 5-cyclohexylpentanoate
PubChem CID101013497
Molecular FormulaC11H19NaO2
Molecular Weight206.26 g/mol
Exact Mass206.13
IUPAC Namesodium 5-cyclohexylpentanoate
SMILESO=C([O-])CCCCC1CCCCC1.[Na+]
InChIInChI=1S/C11H20O2.Na/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;/h10H,1-9H2,(H,12,13);/q;+1/p-1
InChIKeyAVLWCVAOCNUJGQ-UHFFFAOYSA-M
XLogP-1.12
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.26
LogP ≤ 5-1.12
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze sodium 5-cyclohexylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 5-cyclohexylpentanoate?
The IUPAC name of sodium 5-cyclohexylpentanoate (CID 101013497) is sodium 5-cyclohexylpentanoate.
What is the SMILES notation for sodium 5-cyclohexylpentanoate?
The canonical SMILES for sodium 5-cyclohexylpentanoate is O=C([O-])CCCCC1CCCCC1.[Na+].
What is the InChIKey of sodium 5-cyclohexylpentanoate?
The InChIKey is AVLWCVAOCNUJGQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20O2.Na/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;/h10H,1-9H2,(H,12,13);/q;+1/p-1.
What are the key properties of sodium 5-cyclohexylpentanoate?
sodium 5-cyclohexylpentanoate has a molecular weight of 206.26 g/mol, XLogP of -1.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-cyclohexylpentanoate is sourced from PubChem (CID 101013497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).