About sodium 5-cyclohexylpentanoate
sodium 5-cyclohexylpentanoate (PubChem CID 101013497) has the molecular formula C11H19NaO2
and a molecular weight of 206.26 g/mol. Its IUPAC name is sodium 5-cyclohexylpentanoate.
Molecular Properties
| Compound Name | sodium 5-cyclohexylpentanoate |
| PubChem CID | 101013497 |
| Molecular Formula | C11H19NaO2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | sodium 5-cyclohexylpentanoate |
| SMILES | O=C([O-])CCCCC1CCCCC1.[Na+] |
| InChI | InChI=1S/C11H20O2.Na/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;/h10H,1-9H2,(H,12,13);/q;+1/p-1 |
| InChIKey | AVLWCVAOCNUJGQ-UHFFFAOYSA-M |
| XLogP | -1.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 5-cyclohexylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-cyclohexylpentanoate?
The IUPAC name of sodium 5-cyclohexylpentanoate (CID 101013497) is sodium 5-cyclohexylpentanoate.
What is the SMILES notation for sodium 5-cyclohexylpentanoate?
The canonical SMILES for sodium 5-cyclohexylpentanoate is O=C([O-])CCCCC1CCCCC1.[Na+].
What is the InChIKey of sodium 5-cyclohexylpentanoate?
The InChIKey is AVLWCVAOCNUJGQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H20O2.Na/c12-11(13)9-5-4-8-10-6-2-1-3-7-10;/h10H,1-9H2,(H,12,13);/q;+1/p-1.
What are the key properties of sodium 5-cyclohexylpentanoate?
sodium 5-cyclohexylpentanoate has a molecular weight of 206.26 g/mol, XLogP of -1.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-cyclohexylpentanoate is sourced from PubChem (CID 101013497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).