About 4-cyclohexylbutanoate;lead(2+)
4-cyclohexylbutanoate;lead(2+) (PubChem CID 21118991) has the molecular formula C10H17O2Pb+
and a molecular weight of 376.44 g/mol. Its IUPAC name is 4-cyclohexylbutanoate;lead(2+).
Molecular Properties
| Compound Name | 4-cyclohexylbutanoate;lead(2+) |
| PubChem CID | 21118991 |
| Molecular Formula | C10H17O2Pb+ |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 4-cyclohexylbutanoate;lead(2+) |
| SMILES | O=C([O-])CCCC1CCCCC1.[Pb+2] |
| InChI | InChI=1S/C10H18O2.Pb/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h9H,1-8H2,(H,11,12);/q;+2/p-1 |
| InChIKey | BJTQVYZCDLXXCD-UHFFFAOYSA-M |
| XLogP | 1.11 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclohexylbutanoate;lead(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutanoate;lead(2+)?
The IUPAC name of 4-cyclohexylbutanoate;lead(2+) (CID 21118991) is 4-cyclohexylbutanoate;lead(2+).
What is the SMILES notation for 4-cyclohexylbutanoate;lead(2+)?
The canonical SMILES for 4-cyclohexylbutanoate;lead(2+) is O=C([O-])CCCC1CCCCC1.[Pb+2].
What is the InChIKey of 4-cyclohexylbutanoate;lead(2+)?
The InChIKey is BJTQVYZCDLXXCD-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18O2.Pb/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h9H,1-8H2,(H,11,12);/q;+2/p-1.
What are the key properties of 4-cyclohexylbutanoate;lead(2+)?
4-cyclohexylbutanoate;lead(2+) has a molecular weight of 376.44 g/mol, XLogP of 1.11, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutanoate;lead(2+) is sourced from PubChem (CID 21118991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).