About 4-cyclohexylbutanoate;oxalic acid
4-cyclohexylbutanoate;oxalic acid (PubChem CID 91198160) has the molecular formula C12H19O6-
and a molecular weight of 259.28 g/mol. Its IUPAC name is 4-cyclohexylbutanoate;oxalic acid.
Molecular Properties
| Compound Name | 4-cyclohexylbutanoate;oxalic acid |
| PubChem CID | 91198160 |
| Molecular Formula | C12H19O6- |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-cyclohexylbutanoate;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C([O-])CCCC1CCCCC1 |
| InChI | InChI=1S/C10H18O2.C2H2O4/c11-10(12)8-4-7-9-5-2-1-3-6-9;3-1(4)2(5)6/h9H,1-8H2,(H,11,12);(H,3,4)(H,5,6)/p-1 |
| InChIKey | CMFQOGJDWJVFOG-UHFFFAOYSA-M |
| XLogP | 0.64 |
| TPSA | 114.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbutanoate;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutanoate;oxalic acid?
The IUPAC name of 4-cyclohexylbutanoate;oxalic acid (CID 91198160) is 4-cyclohexylbutanoate;oxalic acid.
What is the SMILES notation for 4-cyclohexylbutanoate;oxalic acid?
The canonical SMILES for 4-cyclohexylbutanoate;oxalic acid is O=C(O)C(=O)O.O=C([O-])CCCC1CCCCC1.
What is the InChIKey of 4-cyclohexylbutanoate;oxalic acid?
The InChIKey is CMFQOGJDWJVFOG-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H18O2.C2H2O4/c11-10(12)8-4-7-9-5-2-1-3-6-9;3-1(4)2(5)6/h9H,1-8H2,(H,11,12);(H,3,4)(H,5,6)/p-1.
What are the key properties of 4-cyclohexylbutanoate;oxalic acid?
4-cyclohexylbutanoate;oxalic acid has a molecular weight of 259.28 g/mol, XLogP of 0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutanoate;oxalic acid is sourced from PubChem (CID 91198160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).