About bis(4-cyclohexylbutanoate);iron(2+)
bis(4-cyclohexylbutanoate);iron(2+) (PubChem CID 22104083) has the molecular formula C20H34FeO4
and a molecular weight of 394.33 g/mol. Its IUPAC name is bis(4-cyclohexylbutanoate);iron(2+).
Molecular Properties
| Compound Name | bis(4-cyclohexylbutanoate);iron(2+) |
| PubChem CID | 22104083 |
| Molecular Formula | C20H34FeO4 |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | bis(4-cyclohexylbutanoate);iron(2+) |
| SMILES | O=C([O-])CCCC1CCCCC1.O=C([O-])CCCC1CCCCC1.[Fe+2] |
| InChI | InChI=1S/2C10H18O2.Fe/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*9H,1-8H2,(H,11,12);/q;;+2/p-2 |
| InChIKey | TVPMGMXETCJUDY-UHFFFAOYSA-L |
| XLogP | 2.97 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(4-cyclohexylbutanoate);iron(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-cyclohexylbutanoate);iron(2+)?
The IUPAC name of bis(4-cyclohexylbutanoate);iron(2+) (CID 22104083) is bis(4-cyclohexylbutanoate);iron(2+).
What is the SMILES notation for bis(4-cyclohexylbutanoate);iron(2+)?
The canonical SMILES for bis(4-cyclohexylbutanoate);iron(2+) is O=C([O-])CCCC1CCCCC1.O=C([O-])CCCC1CCCCC1.[Fe+2].
What is the InChIKey of bis(4-cyclohexylbutanoate);iron(2+)?
The InChIKey is TVPMGMXETCJUDY-UHFFFAOYSA-L. The full InChI is InChI=1S/2C10H18O2.Fe/c2*11-10(12)8-4-7-9-5-2-1-3-6-9;/h2*9H,1-8H2,(H,11,12);/q;;+2/p-2.
What are the key properties of bis(4-cyclohexylbutanoate);iron(2+)?
bis(4-cyclohexylbutanoate);iron(2+) has a molecular weight of 394.33 g/mol, XLogP of 2.97, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-cyclohexylbutanoate);iron(2+) is sourced from PubChem (CID 22104083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).