About 4-cyclohexylbutanoyl cyanide
4-cyclohexylbutanoyl cyanide (PubChem CID 15712809) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is 4-cyclohexylbutanoyl cyanide.
Molecular Properties
| Compound Name | 4-cyclohexylbutanoyl cyanide |
| PubChem CID | 15712809 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 4-cyclohexylbutanoyl cyanide |
| SMILES | N#CC(=O)CCCC1CCCCC1 |
| InChI | InChI=1S/C11H17NO/c12-9-11(13)8-4-7-10-5-2-1-3-6-10/h10H,1-8H2 |
| InChIKey | JEQMWNLHWCAEES-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbutanoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutanoyl cyanide?
The IUPAC name of 4-cyclohexylbutanoyl cyanide (CID 15712809) is 4-cyclohexylbutanoyl cyanide.
What is the SMILES notation for 4-cyclohexylbutanoyl cyanide?
The canonical SMILES for 4-cyclohexylbutanoyl cyanide is N#CC(=O)CCCC1CCCCC1.
What is the InChIKey of 4-cyclohexylbutanoyl cyanide?
The InChIKey is JEQMWNLHWCAEES-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO/c12-9-11(13)8-4-7-10-5-2-1-3-6-10/h10H,1-8H2.
What are the key properties of 4-cyclohexylbutanoyl cyanide?
4-cyclohexylbutanoyl cyanide has a molecular weight of 179.26 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutanoyl cyanide is sourced from PubChem (CID 15712809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).