About 4-cyclohexylbutanoate;hydron;mercury(2+)
4-cyclohexylbutanoate;hydron;mercury(2+) (PubChem CID 21118992) has the molecular formula C10H18HgO2+2
and a molecular weight of 370.84 g/mol. Its IUPAC name is 4-cyclohexylbutanoate;hydron;mercury(2+).
Molecular Properties
| Compound Name | 4-cyclohexylbutanoate;hydron;mercury(2+) |
| PubChem CID | 21118992 |
| Molecular Formula | C10H18HgO2+2 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-cyclohexylbutanoate;hydron;mercury(2+) |
| SMILES | O=C([O-])CCCC1CCCCC1.[H+].[Hg+2] |
| InChI | InChI=1S/C10H18O2.Hg/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h9H,1-8H2,(H,11,12);/q;+2 |
| InChIKey | YHWQMMGCWVZZBS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexylbutanoate;hydron;mercury(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylbutanoate;hydron;mercury(2+)?
The IUPAC name of 4-cyclohexylbutanoate;hydron;mercury(2+) (CID 21118992) is 4-cyclohexylbutanoate;hydron;mercury(2+).
What is the SMILES notation for 4-cyclohexylbutanoate;hydron;mercury(2+)?
The canonical SMILES for 4-cyclohexylbutanoate;hydron;mercury(2+) is O=C([O-])CCCC1CCCCC1.[H+].[Hg+2].
What is the InChIKey of 4-cyclohexylbutanoate;hydron;mercury(2+)?
The InChIKey is YHWQMMGCWVZZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2.Hg/c11-10(12)8-4-7-9-5-2-1-3-6-9;/h9H,1-8H2,(H,11,12);/q;+2.
What are the key properties of 4-cyclohexylbutanoate;hydron;mercury(2+)?
4-cyclohexylbutanoate;hydron;mercury(2+) has a molecular weight of 370.84 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylbutanoate;hydron;mercury(2+) is sourced from PubChem (CID 21118992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).