About 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene
2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene (PubChem CID 101014635) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene.
Analyze 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene?
The IUPAC name of 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene (CID 101014635) is 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene.
What is the SMILES notation for 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene?
The canonical SMILES for 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene is c1cc2c3c(c1)=NCC=3CCN2.
What is the InChIKey of 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene?
The InChIKey is OZEIWFQBLVQZRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2/c1-2-8-10-7(4-5-11-8)6-12-9(10)3-1/h1-3,11H,4-6H2.
What are the key properties of 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene?
2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene has a molecular weight of 158.20 g/mol, XLogP of 0.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diazatricyclo[6.3.1.04,12]dodeca-1,4(12),8,10-tetraene is sourced from PubChem (CID 101014635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).