C20H20O3S2 — CID 101016188
(3Z,4Z)-3,4-bis[1-(2,5-dimethylthiophen-3-yl)ethylidene]oxolane-2,5-dione (PubChem CID 101016188) has the molecular formula C20H20O3S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is (3Z,4Z)-3,4-bis[1-(2,5-dimethylthiophen-3-yl)ethylidene]oxolane-2,5-dione.
| Compound Name | (3Z,4Z)-3,4-bis[1-(2,5-dimethylthiophen-3-yl)ethylidene]oxolane-2,5-dione |
|---|---|
| PubChem CID | 101016188 |
| Molecular Formula | C20H20O3S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | (3Z,4Z)-3,4-bis[1-(2,5-dimethylthiophen-3-yl)ethylidene]oxolane-2,5-dione |
| SMILES | C/C(=C1/C(=O)OC(=O)/C1=C(/C)c1cc(C)sc1C)c1cc(C)sc1C |
| InChI | InChI=1S/C20H20O3S2/c1-9-7-15(13(5)24-9)11(3)17-18(20(22)23-19(17)21)12(4)16-8-10(2)25-14(16)6/h7-8H,1-6H3/b17-11-,18-12- |
| InChIKey | VIWHADIKUNZVAW-WHYMJUELSA-N |
| XLogP | 5.37 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|