C21H22O4 — CID 101023130
(2S,3R)-3-methyl-7-(oxan-2-yloxy)-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 101023130) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2S,3R)-3-methyl-7-(oxan-2-yloxy)-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | (2S,3R)-3-methyl-7-(oxan-2-yloxy)-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 101023130 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (2S,3R)-3-methyl-7-(oxan-2-yloxy)-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | C[C@H]1C(=O)c2ccc(OC3CCCCO3)cc2O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H22O4/c1-14-20(22)17-11-10-16(24-19-9-5-6-12-23-19)13-18(17)25-21(14)15-7-3-2-4-8-15/h2-4,7-8,10-11,13-14,19,21H,5-6,9,12H2,1H3/t14-,19?,21-/m0/s1 |
| InChIKey | LELWUUBOBBRMBW-VVHKJBIHSA-N |
| XLogP | 4.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |