C17H26O3 — CID 101023990
[(E)-3-formyl-5-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]pent-2-enyl] acetate (PubChem CID 101023990) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is [(E)-3-formyl-5-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]pent-2-enyl] acetate.
| Compound Name | [(E)-3-formyl-5-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]pent-2-enyl] acetate |
|---|---|
| PubChem CID | 101023990 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | [(E)-3-formyl-5-[(1S)-2,6,6-trimethylcyclohex-2-en-1-yl]pent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(/C=O)CC[C@@H]1C(C)=CCCC1(C)C |
| InChI | InChI=1S/C17H26O3/c1-13-6-5-10-17(3,4)16(13)8-7-15(12-18)9-11-20-14(2)19/h6,9,12,16H,5,7-8,10-11H2,1-4H3/b15-9+/t16-/m1/s1 |
| InChIKey | FBYATBNUYFTTBA-HTRKUNOGSA-N |
| XLogP | 3.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|