C7H12INO3 — CID 101024617
methyl (2R,3S)-3-iodo-2-methoxypyrrolidine-1-carboxylate (PubChem CID 101024617) has the molecular formula C7H12INO3 and a molecular weight of 285.08 g/mol. Its IUPAC name is methyl (2R,3S)-3-iodo-2-methoxypyrrolidine-1-carboxylate.
| Compound Name | methyl (2R,3S)-3-iodo-2-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101024617 |
| Molecular Formula | C7H12INO3 |
| Molecular Weight | 285.08 g/mol |
| Exact Mass | 284.99 |
| IUPAC Name | methyl (2R,3S)-3-iodo-2-methoxypyrrolidine-1-carboxylate |
| SMILES | COC(=O)N1CC[C@H](I)[C@H]1OC |
| InChI | InChI=1S/C7H12INO3/c1-11-6-5(8)3-4-9(6)7(10)12-2/h5-6H,3-4H2,1-2H3/t5-,6+/m0/s1 |
| InChIKey | BQGVBAFCOWGABS-NTSWFWBYSA-N |
| XLogP | 1.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.08 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|