C9H15NO4 — CID 83848056
2-ethyl-1-methoxycarbonylpyrrolidine-3-carboxylic acid (PubChem CID 83848056) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-ethyl-1-methoxycarbonylpyrrolidine-3-carboxylic acid.
| Compound Name | 2-ethyl-1-methoxycarbonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83848056 |
| Molecular Formula | C9H15NO4 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-ethyl-1-methoxycarbonylpyrrolidine-3-carboxylic acid |
| SMILES | CCC1C(C(=O)O)CCN1C(=O)OC |
| InChI | InChI=1S/C9H15NO4/c1-3-7-6(8(11)12)4-5-10(7)9(13)14-2/h6-7H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | BWPOXOQFMRTLOS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |