C25H40O4 — CID 101025323
(1S)-3-ethenyl-1-[(S)-hydroxy-(3,3,11,11-tetramethyl-1,5-dioxaspiro[5.5]undec-9-en-10-yl)methyl]-2,2,4-trimethylcyclohex-3-en-1-ol (PubChem CID 101025323) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (1S)-3-ethenyl-1-[(S)-hydroxy-(3,3,11,11-tetramethyl-1,5-dioxaspiro[5.5]undec-9-en-10-yl)methyl]-2,2,4-trimethylcyclohex-3-en-1-ol.
| Compound Name | (1S)-3-ethenyl-1-[(S)-hydroxy-(3,3,11,11-tetramethyl-1,5-dioxaspiro[5.5]undec-9-en-10-yl)methyl]-2,2,4-trimethylcyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 101025323 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (1S)-3-ethenyl-1-[(S)-hydroxy-(3,3,11,11-tetramethyl-1,5-dioxaspiro[5.5]undec-9-en-10-yl)methyl]-2,2,4-trimethylcyclohex-3-en-1-ol |
| SMILES | C=CC1=C(C)CC[C@@](O)([C@@H](O)C2=CCCC3(OCC(C)(C)CO3)C2(C)C)C1(C)C |
| InChI | InChI=1S/C25H40O4/c1-9-18-17(2)12-14-24(27,22(18,5)6)20(26)19-11-10-13-25(23(19,7)8)28-15-21(3,4)16-29-25/h9,11,20,26-27H,1,10,12-16H2,2-8H3/t20-,24+/m0/s1 |
| InChIKey | JEQOJZSBDMGTDN-GBXCKJPGSA-N |
| XLogP | 4.92 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|