C17H24O4 — CID 163913783
(3-prop-1-en-2-yloxiran-2-yl)-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)methanone (PubChem CID 163913783) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3-prop-1-en-2-yloxiran-2-yl)-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)methanone.
| Compound Name | (3-prop-1-en-2-yloxiran-2-yl)-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)methanone |
|---|---|
| PubChem CID | 163913783 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3-prop-1-en-2-yloxiran-2-yl)-(6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-en-7-yl)methanone |
| SMILES | C=C(C)C1OC1C(=O)C1=C(C)CCC2(OCCO2)C1(C)C |
| InChI | InChI=1S/C17H24O4/c1-10(2)14-15(21-14)13(18)12-11(3)6-7-17(16(12,4)5)19-8-9-20-17/h14-15H,1,6-9H2,2-5H3 |
| InChIKey | QULSRPFTPLECAD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|