C40H31NO9 — CID 101025664
3-(4-nitrophenoxy)propyl 3,18,24,31-tetraoxaheptacyclo[18.14.0.04,17.05,10.011,16.022,33.025,30]tetratriaconta-1(20),4(17),5,7,9,11,13,15,21,25(30),26,28,33-tridecaene-27-carboxylate (PubChem CID 101025664) has the molecular formula C40H31NO9 and a molecular weight of 669.69 g/mol. Its IUPAC name is 3-(4-nitrophenoxy)propyl 3,18,24,31-tetraoxaheptacyclo[18.14.0.04,17.05,10.011,16.022,33.025,30]tetratriaconta-1(20),4(17),5,7,9,11,13,15,21,25(30),26,28,33-tridecaene-27-carboxylate.
| Compound Name | 3-(4-nitrophenoxy)propyl 3,18,24,31-tetraoxaheptacyclo[18.14.0.04,17.05,10.011,16.022,33.025,30]tetratriaconta-1(20),4(17),5,7,9,11,13,15,21,25(30),26,28,33-tridecaene-27-carboxylate |
|---|---|
| PubChem CID | 101025664 |
| Molecular Formula | C40H31NO9 |
| Molecular Weight | 669.69 g/mol |
| Exact Mass | 669.20 |
| IUPAC Name | 3-(4-nitrophenoxy)propyl 3,18,24,31-tetraoxaheptacyclo[18.14.0.04,17.05,10.011,16.022,33.025,30]tetratriaconta-1(20),4(17),5,7,9,11,13,15,21,25(30),26,28,33-tridecaene-27-carboxylate |
| SMILES | O=C(OCCCOc1ccc([N+](=O)[O-])cc1)c1ccc2c(c1)OCc1cc3c(cc1CO2)COc1c(c2ccccc2c2ccccc12)OC3 |
| InChI | InChI=1S/C40H31NO9/c42-40(46-17-5-16-45-31-13-11-30(12-14-31)41(43)44)25-10-15-36-37(20-25)48-22-27-19-29-24-50-39-35-9-4-2-7-33(35)32-6-1-3-8-34(32)38(39)49-23-28(29)18-26(27)21-47-36/h1-4,6-15,18-20H,5,16-17,21-24H2 |
| InChIKey | NLJPMTJTPSPUFT-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 115.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.69 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|