C18H15F8N — CID 101027767
N,N-diethyl-2,3,5,6-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-phenylethyl)aniline (PubChem CID 101027767) has the molecular formula C18H15F8N and a molecular weight of 397.31 g/mol. Its IUPAC name is N,N-diethyl-2,3,5,6-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-phenylethyl)aniline.
| Compound Name | N,N-diethyl-2,3,5,6-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-phenylethyl)aniline |
|---|---|
| PubChem CID | 101027767 |
| Molecular Formula | C18H15F8N |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N,N-diethyl-2,3,5,6-tetrafluoro-4-(1,1,2,2-tetrafluoro-2-phenylethyl)aniline |
| SMILES | CCN(CC)c1c(F)c(F)c(C(F)(F)C(F)(F)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C18H15F8N/c1-3-27(4-2)16-14(21)12(19)11(13(20)15(16)22)18(25,26)17(23,24)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | GJLRYRZXKGVQNE-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|