C18H30O2Si2 — CID 101028370
(4R,5R)-4,5-bis(2-trimethylsilylethynyl)octa-1,7-diene-4,5-diol (PubChem CID 101028370) has the molecular formula C18H30O2Si2 and a molecular weight of 334.61 g/mol. Its IUPAC name is (4R,5R)-4,5-bis(2-trimethylsilylethynyl)octa-1,7-diene-4,5-diol.
| Compound Name | (4R,5R)-4,5-bis(2-trimethylsilylethynyl)octa-1,7-diene-4,5-diol |
|---|---|
| PubChem CID | 101028370 |
| Molecular Formula | C18H30O2Si2 |
| Molecular Weight | 334.61 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (4R,5R)-4,5-bis(2-trimethylsilylethynyl)octa-1,7-diene-4,5-diol |
| SMILES | C=CC[C@@](O)(C#C[Si](C)(C)C)[C@](O)(C#C[Si](C)(C)C)CC=C |
| InChI | InChI=1S/C18H30O2Si2/c1-9-11-17(19,13-15-21(3,4)5)18(20,12-10-2)14-16-22(6,7)8/h9-10,19-20H,1-2,11-12H2,3-8H3/t17-,18-/m1/s1 |
| InChIKey | VXTMZNQKDWXAGD-QZTJIDSGSA-N |
| XLogP | 3.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.61 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|