C18H30OSi2 — CID 10543617
4-prop-2-enyl-1-trimethylsilyl-3-(2-trimethylsilylethynyl)hept-6-en-1-yn-3-ol (PubChem CID 10543617) has the molecular formula C18H30OSi2 and a molecular weight of 318.61 g/mol. Its IUPAC name is 4-prop-2-enyl-1-trimethylsilyl-3-(2-trimethylsilylethynyl)hept-6-en-1-yn-3-ol.
| Compound Name | 4-prop-2-enyl-1-trimethylsilyl-3-(2-trimethylsilylethynyl)hept-6-en-1-yn-3-ol |
|---|---|
| PubChem CID | 10543617 |
| Molecular Formula | C18H30OSi2 |
| Molecular Weight | 318.61 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 4-prop-2-enyl-1-trimethylsilyl-3-(2-trimethylsilylethynyl)hept-6-en-1-yn-3-ol |
| SMILES | C=CCC(CC=C)C(O)(C#C[Si](C)(C)C)C#C[Si](C)(C)C |
| InChI | InChI=1S/C18H30OSi2/c1-9-11-17(12-10-2)18(19,13-15-20(3,4)5)14-16-21(6,7)8/h9-10,17,19H,1-2,11-12H2,3-8H3 |
| InChIKey | BOJJQRCJCPTOQF-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.61 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|