C16H28OSi — CID 10491896
6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-ol (PubChem CID 10491896) has the molecular formula C16H28OSi and a molecular weight of 264.49 g/mol. Its IUPAC name is 6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-ol.
| Compound Name | 6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-ol |
|---|---|
| PubChem CID | 10491896 |
| Molecular Formula | C16H28OSi |
| Molecular Weight | 264.49 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | 6-(2-trimethylsilylethynyl)undeca-1,10-dien-6-ol |
| SMILES | C=CCCCC(O)(C#C[Si](C)(C)C)CCCC=C |
| InChI | InChI=1S/C16H28OSi/c1-6-8-10-12-16(17,13-11-9-7-2)14-15-18(3,4)5/h6-7,17H,1-2,8-13H2,3-5H3 |
| InChIKey | DNFGGRAAWKTALI-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|