C16H24OSi — CID 15247300
5-ethynylnon-1-en-8-yn-5-yloxy-dimethyl-prop-2-enylsilane (PubChem CID 15247300) has the molecular formula C16H24OSi and a molecular weight of 260.45 g/mol. Its IUPAC name is 5-ethynylnon-1-en-8-yn-5-yloxy-dimethyl-prop-2-enylsilane.
| Compound Name | 5-ethynylnon-1-en-8-yn-5-yloxy-dimethyl-prop-2-enylsilane |
|---|---|
| PubChem CID | 15247300 |
| Molecular Formula | C16H24OSi |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 5-ethynylnon-1-en-8-yn-5-yloxy-dimethyl-prop-2-enylsilane |
| SMILES | C#CCCC(C#C)(CCC=C)O[Si](C)(C)CC=C |
| InChI | InChI=1S/C16H24OSi/c1-7-11-13-16(10-4,14-12-8-2)17-18(5,6)15-9-3/h1,4,8-9H,2-3,11-15H2,5-6H3 |
| InChIKey | DTTGZBZSHTUKNT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|