C17H30O2 — CID 101031957
(2R,3R)-2-ethyl-8,8-dimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane (PubChem CID 101031957) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (2R,3R)-2-ethyl-8,8-dimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane.
| Compound Name | (2R,3R)-2-ethyl-8,8-dimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 101031957 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (2R,3R)-2-ethyl-8,8-dimethyl-3-(3-methylbut-2-enyl)-7,9-dioxaspiro[4.5]decane |
| SMILES | CC[C@@H]1CC2(COC(C)(C)OC2)C[C@H]1CC=C(C)C |
| InChI | InChI=1S/C17H30O2/c1-6-14-9-17(10-15(14)8-7-13(2)3)11-18-16(4,5)19-12-17/h7,14-15H,6,8-12H2,1-5H3/t14-,15-/m1/s1 |
| InChIKey | VOJRJFBXSBJNHI-HUUCEWRRSA-N |
| XLogP | 4.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|