C18H29NO6S — CID 101036698
2-methylsulfonylethyl N-(4,4-diethoxy-2-phenylbutyl)carbamate (PubChem CID 101036698) has the molecular formula C18H29NO6S and a molecular weight of 387.50 g/mol. Its IUPAC name is 2-methylsulfonylethyl N-(4,4-diethoxy-2-phenylbutyl)carbamate.
| Compound Name | 2-methylsulfonylethyl N-(4,4-diethoxy-2-phenylbutyl)carbamate |
|---|---|
| PubChem CID | 101036698 |
| Molecular Formula | C18H29NO6S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 2-methylsulfonylethyl N-(4,4-diethoxy-2-phenylbutyl)carbamate |
| SMILES | CCOC(CC(CNC(=O)OCCS(C)(=O)=O)c1ccccc1)OCC |
| InChI | InChI=1S/C18H29NO6S/c1-4-23-17(24-5-2)13-16(15-9-7-6-8-10-15)14-19-18(20)25-11-12-26(3,21)22/h6-10,16-17H,4-5,11-14H2,1-3H3,(H,19,20) |
| InChIKey | WGONLHKYNIHWHK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|