C12H15NO5S — CID 57314239
2-methylsulfonylethyl N-(2-phenylacetyl)carbamate (PubChem CID 57314239) has the molecular formula C12H15NO5S and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-methylsulfonylethyl N-(2-phenylacetyl)carbamate.
| Compound Name | 2-methylsulfonylethyl N-(2-phenylacetyl)carbamate |
|---|---|
| PubChem CID | 57314239 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-methylsulfonylethyl N-(2-phenylacetyl)carbamate |
| SMILES | CS(=O)(=O)CCOC(=O)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H15NO5S/c1-19(16,17)8-7-18-12(15)13-11(14)9-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,13,14,15) |
| InChIKey | COWIHTRPIMLOOP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |