About manganese(2+);2-methylcyclohexen-1-olate;chloride
manganese(2+);2-methylcyclohexen-1-olate;chloride (PubChem CID 101036940) has the molecular formula C7H11ClMnO
and a molecular weight of 201.55 g/mol. Its IUPAC name is manganese(2+);2-methylcyclohexen-1-olate;chloride.
Molecular Properties
| Compound Name | manganese(2+);2-methylcyclohexen-1-olate;chloride |
| PubChem CID | 101036940 |
| Molecular Formula | C7H11ClMnO |
| Molecular Weight | 201.55 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | manganese(2+);2-methylcyclohexen-1-olate;chloride |
| SMILES | CC1=C([O-])CCCC1.[Cl-].[Mn+2] |
| InChI | InChI=1S/C7H12O.ClH.Mn/c1-6-4-2-3-5-7(6)8;;/h8H,2-5H2,1H3;1H;/q;;+2/p-2 |
| InChIKey | JZFULZCQVQMXIM-UHFFFAOYSA-L |
| XLogP | -1.80 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.55 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze manganese(2+);2-methylcyclohexen-1-olate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);2-methylcyclohexen-1-olate;chloride?
The IUPAC name of manganese(2+);2-methylcyclohexen-1-olate;chloride (CID 101036940) is manganese(2+);2-methylcyclohexen-1-olate;chloride.
What is the SMILES notation for manganese(2+);2-methylcyclohexen-1-olate;chloride?
The canonical SMILES for manganese(2+);2-methylcyclohexen-1-olate;chloride is CC1=C([O-])CCCC1.[Cl-].[Mn+2].
What is the InChIKey of manganese(2+);2-methylcyclohexen-1-olate;chloride?
The InChIKey is JZFULZCQVQMXIM-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H12O.ClH.Mn/c1-6-4-2-3-5-7(6)8;;/h8H,2-5H2,1H3;1H;/q;;+2/p-2.
What are the key properties of manganese(2+);2-methylcyclohexen-1-olate;chloride?
manganese(2+);2-methylcyclohexen-1-olate;chloride has a molecular weight of 201.55 g/mol, XLogP of -1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);2-methylcyclohexen-1-olate;chloride is sourced from PubChem (CID 101036940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).