C12H11NO3S2 — CID 101039583
(3aR)-8-methyl-3-oxo-2,3a-dihydro-1H-[1,3]thiazolo[2,3-c][1,4]benzothiazepine-4,10-dione (PubChem CID 101039583) has the molecular formula C12H11NO3S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3aR)-8-methyl-3-oxo-2,3a-dihydro-1H-[1,3]thiazolo[2,3-c][1,4]benzothiazepine-4,10-dione.
| Compound Name | (3aR)-8-methyl-3-oxo-2,3a-dihydro-1H-[1,3]thiazolo[2,3-c][1,4]benzothiazepine-4,10-dione |
|---|---|
| PubChem CID | 101039583 |
| Molecular Formula | C12H11NO3S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | (3aR)-8-methyl-3-oxo-2,3a-dihydro-1H-[1,3]thiazolo[2,3-c][1,4]benzothiazepine-4,10-dione |
| SMILES | Cc1ccc2c(c1)C(=O)N1CCS(=O)[C@@H]1C(=O)S2 |
| InChI | InChI=1S/C12H11NO3S2/c1-7-2-3-9-8(6-7)10(14)13-4-5-18(16)11(13)12(15)17-9/h2-3,6,11H,4-5H2,1H3/t11-,18?/m1/s1 |
| InChIKey | VRXBYSZHCUPLRU-SSJGJQFISA-N |
| XLogP | 1.16 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|