C9H14O4 — CID 101044257
(3aS,6S)-3-methoxy-3,4,5,6-tetrahydro-1H-2-benzofuran-3a,6-diol (PubChem CID 101044257) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is (3aS,6S)-3-methoxy-3,4,5,6-tetrahydro-1H-2-benzofuran-3a,6-diol.
| Compound Name | (3aS,6S)-3-methoxy-3,4,5,6-tetrahydro-1H-2-benzofuran-3a,6-diol |
|---|---|
| PubChem CID | 101044257 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | (3aS,6S)-3-methoxy-3,4,5,6-tetrahydro-1H-2-benzofuran-3a,6-diol |
| SMILES | COC1OCC2=C[C@@H](O)CC[C@]21O |
| InChI | InChI=1S/C9H14O4/c1-12-8-9(11)3-2-7(10)4-6(9)5-13-8/h4,7-8,10-11H,2-3,5H2,1H3/t7-,8?,9-/m0/s1 |
| InChIKey | NNLPDAIYRIHFPE-SMOXQLQSSA-N |
| XLogP | -0.20 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|