C21H21NO2 — CID 101048772
10-[(E)-2,4,4-trimethylpent-2-enoyl]acridin-9-one (PubChem CID 101048772) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 10-[(E)-2,4,4-trimethylpent-2-enoyl]acridin-9-one.
| Compound Name | 10-[(E)-2,4,4-trimethylpent-2-enoyl]acridin-9-one |
|---|---|
| PubChem CID | 101048772 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 10-[(E)-2,4,4-trimethylpent-2-enoyl]acridin-9-one |
| SMILES | C/C(=C\C(C)(C)C)C(=O)n1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C21H21NO2/c1-14(13-21(2,3)4)20(24)22-17-11-7-5-9-15(17)19(23)16-10-6-8-12-18(16)22/h5-13H,1-4H3/b14-13+ |
| InChIKey | BRRPARXLNRYCJT-BUHFOSPRSA-N |
| XLogP | 4.79 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|