C18H31NO5S — CID 101054642
1-[(1'S,2R,4'R)-7',7'-dimethyl-4-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide (PubChem CID 101054642) has the molecular formula C18H31NO5S and a molecular weight of 373.52 g/mol. Its IUPAC name is 1-[(1'S,2R,4'R)-7',7'-dimethyl-4-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide.
| Compound Name | 1-[(1'S,2R,4'R)-7',7'-dimethyl-4-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide |
|---|---|
| PubChem CID | 101054642 |
| Molecular Formula | C18H31NO5S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 1-[(1'S,2R,4'R)-7',7'-dimethyl-4-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-di(propan-2-yl)methanesulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)C[C@]12CC[C@H](C[C@]13OCC(=O)O3)C2(C)C |
| InChI | InChI=1S/C18H31NO5S/c1-12(2)19(13(3)4)25(21,22)11-17-8-7-14(16(17,5)6)9-18(17)23-10-15(20)24-18/h12-14H,7-11H2,1-6H3/t14-,17+,18-/m1/s1 |
| InChIKey | HTYQAYBLRGLWTG-FHLIZLRMSA-N |
| XLogP | 2.53 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |