C15H27NO5S — CID 10854118
1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-dimethylmethanesulfonamide (PubChem CID 10854118) has the molecular formula C15H27NO5S and a molecular weight of 333.45 g/mol. Its IUPAC name is 1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-dimethylmethanesulfonamide.
| Compound Name | 1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-dimethylmethanesulfonamide |
|---|---|
| PubChem CID | 10854118 |
| Molecular Formula | C15H27NO5S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[(1'R,2R,4S,4'S)-4-(hydroxymethyl)-7',7'-dimethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]-N,N-dimethylmethanesulfonamide |
| SMILES | CN(C)S(=O)(=O)C[C@@]12CC[C@@H](C[C@]13OC[C@H](CO)O3)C2(C)C |
| InChI | InChI=1S/C15H27NO5S/c1-13(2)11-5-6-14(13,10-22(18,19)16(3)4)15(7-11)20-9-12(8-17)21-15/h11-12,17H,5-10H2,1-4H3/t11-,12-,14+,15+/m0/s1 |
| InChIKey | MKRACYVTHNREMJ-DDHJSBNISA-N |
| XLogP | 0.81 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |