C19H33NO5S — CID 10271567
N,N-di(propan-2-yl)-1-[(4R)-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide (PubChem CID 10271567) has the molecular formula C19H33NO5S and a molecular weight of 387.54 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-1-[(4R)-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide.
| Compound Name | N,N-di(propan-2-yl)-1-[(4R)-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide |
|---|---|
| PubChem CID | 10271567 |
| Molecular Formula | C19H33NO5S |
| Molecular Weight | 387.54 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N,N-di(propan-2-yl)-1-[(4R)-4,7',7'-trimethyl-5-oxospiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane]-1'-yl]methanesulfonamide |
| SMILES | CC(C)N(C(C)C)S(=O)(=O)CC12CCC(CC13OC(=O)[C@@H](C)O3)C2(C)C |
| InChI | InChI=1S/C19H33NO5S/c1-12(2)20(13(3)4)26(22,23)11-18-9-8-15(17(18,6)7)10-19(18)24-14(5)16(21)25-19/h12-15H,8-11H2,1-7H3/t14-,15?,18?,19?/m1/s1 |
| InChIKey | GQARGMOMMUGTRV-IHRRGDQRSA-N |
| XLogP | 2.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |