C16H29BrO6 — CID 101058542
(4R)-4-[(E,1R,2R)-5-bromo-2-(2-ethoxyethoxy)-1-(methoxymethoxy)pent-3-enyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 101058542) has the molecular formula C16H29BrO6 and a molecular weight of 397.31 g/mol. Its IUPAC name is (4R)-4-[(E,1R,2R)-5-bromo-2-(2-ethoxyethoxy)-1-(methoxymethoxy)pent-3-enyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4R)-4-[(E,1R,2R)-5-bromo-2-(2-ethoxyethoxy)-1-(methoxymethoxy)pent-3-enyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 101058542 |
| Molecular Formula | C16H29BrO6 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (4R)-4-[(E,1R,2R)-5-bromo-2-(2-ethoxyethoxy)-1-(methoxymethoxy)pent-3-enyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CCOCCO[C@H](/C=C/CBr)[C@@H](OCOC)[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H29BrO6/c1-5-19-9-10-20-13(7-6-8-17)15(21-12-18-4)14-11-22-16(2,3)23-14/h6-7,13-15H,5,8-12H2,1-4H3/b7-6+/t13-,14-,15-/m1/s1 |
| InChIKey | ZEODJHJJPGBURL-ZQXYTJGRSA-N |
| XLogP | 2.50 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|