C23H24NO2PS — CID 101060279
(2R,3S)-2-diphenylphosphoryl-3-ethyl-1-(4-methylphenyl)sulfinylaziridine (PubChem CID 101060279) has the molecular formula C23H24NO2PS and a molecular weight of 409.49 g/mol. Its IUPAC name is (2R,3S)-2-diphenylphosphoryl-3-ethyl-1-(4-methylphenyl)sulfinylaziridine.
| Compound Name | (2R,3S)-2-diphenylphosphoryl-3-ethyl-1-(4-methylphenyl)sulfinylaziridine |
|---|---|
| PubChem CID | 101060279 |
| Molecular Formula | C23H24NO2PS |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (2R,3S)-2-diphenylphosphoryl-3-ethyl-1-(4-methylphenyl)sulfinylaziridine |
| SMILES | CC[C@H]1[C@@H](P(=O)(c2ccccc2)c2ccccc2)N1S(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24NO2PS/c1-3-22-23(24(22)28(26)21-16-14-18(2)15-17-21)27(25,19-10-6-4-7-11-19)20-12-8-5-9-13-20/h4-17,22-23H,3H2,1-2H3/t22-,23+,24?,28?/m0/s1 |
| InChIKey | OOPFFMCLOJNWMY-ZONGWSEBSA-N |
| XLogP | 4.45 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|