C16H20O3 — CID 101060938
(2S,3S)-1,5-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-ol (PubChem CID 101060938) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2S,3S)-1,5-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-ol.
| Compound Name | (2S,3S)-1,5-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
|---|---|
| PubChem CID | 101060938 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (2S,3S)-1,5-dimethyl-2-phenylmethoxy-8-oxabicyclo[3.2.1]oct-6-en-3-ol |
| SMILES | CC12C=CC(C)(O1)[C@@H](OCc1ccccc1)[C@@H](O)C2 |
| InChI | InChI=1S/C16H20O3/c1-15-8-9-16(2,19-15)14(13(17)10-15)18-11-12-6-4-3-5-7-12/h3-9,13-14,17H,10-11H2,1-2H3/t13-,14-,15?,16?/m0/s1 |
| InChIKey | OLACDSHGOYDNFM-FXQLRMTLSA-N |
| XLogP | 2.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|